C40H42N2O6S2 — CID 6678275
8-[[3-[4-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid (PubChem CID 6678275) has the molecular formula C40H42N2O6S2 and a molecular weight of 710.92 g/mol. Its IUPAC name is 8-[[3-[4-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid.
| Compound Name | 8-[[3-[4-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 6678275 |
| Molecular Formula | C40H42N2O6S2 |
| Molecular Weight | 710.92 g/mol |
| Exact Mass | 710.25 |
| IUPAC Name | 8-[[3-[4-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)NCc1cccc(-c2ccc([C@@H]3O[C@H](CSc4nc5ccccc5s4)C[C@H](c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C40H42N2O6S2/c43-25-27-14-16-30(17-15-27)35-23-33(26-49-40-42-34-10-5-6-11-36(34)50-40)47-39(48-35)31-20-18-29(19-21-31)32-9-7-8-28(22-32)24-41-37(44)12-3-1-2-4-13-38(45)46/h5-11,14-22,33,35,39,43H,1-4,12-13,23-26H2,(H,41,44)(H,45,46)/t33-,35+,39+/m0/s1 |
| InChIKey | ZYNRVPDPPDKKIB-FTMWVPAESA-N |
| XLogP | 8.83 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.92 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|