C39H42N4O5S2 — CID 3417411
N'-(2-aminophenyl)-N-[[4-[4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide (PubChem CID 3417411) has the molecular formula C39H42N4O5S2 and a molecular weight of 710.92 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[4-[4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[4-[4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 3417411 |
| Molecular Formula | C39H42N4O5S2 |
| Molecular Weight | 710.92 g/mol |
| Exact Mass | 710.26 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[4-[4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)NCc1ccc(C2OC(CSc3nc4ccccc4s3)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C39H42N4O5S2/c40-31-8-4-5-9-32(31)42-37(46)13-3-1-2-12-36(45)41-23-26-14-20-29(21-15-26)38-47-30(22-34(48-38)28-18-16-27(24-44)17-19-28)25-49-39-43-33-10-6-7-11-35(33)50-39/h4-11,14-21,30,34,38,44H,1-3,12-13,22-25,40H2,(H,41,45)(H,42,46) |
| InChIKey | WJFAYNHUOZBXJD-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.92 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|