C38H40N4O5S2 — CID 6674659
N'-(2-aminophenyl)-N-[[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide (PubChem CID 6674659) has the molecular formula C38H40N4O5S2 and a molecular weight of 696.90 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 6674659 |
| Molecular Formula | C38H40N4O5S2 |
| Molecular Weight | 696.90 g/mol |
| Exact Mass | 696.24 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)NCc1ccc([C@H]2O[C@@H](CSc3nc4ccccc4s3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C38H40N4O5S2/c39-30-7-1-2-8-31(30)41-36(45)12-6-5-11-35(44)40-22-25-13-19-28(20-14-25)37-46-29(21-33(47-37)27-17-15-26(23-43)16-18-27)24-48-38-42-32-9-3-4-10-34(32)49-38/h1-4,7-10,13-20,29,33,37,43H,5-6,11-12,21-24,39H2,(H,40,44)(H,41,45)/t29-,33+,37+/m1/s1 |
| InChIKey | SPKZUBVFEJSCNV-CVXWAMIDSA-N |
| XLogP | 7.52 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.90 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|