C37H37N3O6S2 — CID 6674679
N-[[2-[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide (PubChem CID 6674679) has the molecular formula C37H37N3O6S2 and a molecular weight of 683.85 g/mol. Its IUPAC name is N-[[2-[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide.
| Compound Name | N-[[2-[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide |
|---|---|
| PubChem CID | 6674679 |
| Molecular Formula | C37H37N3O6S2 |
| Molecular Weight | 683.85 g/mol |
| Exact Mass | 683.21 |
| IUPAC Name | N-[[2-[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide |
| SMILES | O=C(CCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CSc3nc4ccccc4s3)C[C@@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C37H37N3O6S2/c41-22-24-12-14-26(15-13-24)32-20-29(23-47-37-39-31-8-3-4-9-33(31)48-37)45-36(46-32)27-18-16-25(17-19-27)30-7-2-1-6-28(30)21-38-34(42)10-5-11-35(43)40-44/h1-4,6-9,12-19,29,32,36,41,44H,5,10-11,20-23H2,(H,38,42)(H,40,43)/t29-,32+,36+/m1/s1 |
| InChIKey | USOVZHYTDJWADD-NHJGKXACSA-N |
| XLogP | 7.09 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.85 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|