C43H45N3O4S2 — CID 6702222
1-(1-adamantyl)-3-[[2-[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6702222) has the molecular formula C43H45N3O4S2 and a molecular weight of 731.98 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[2-[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[2-[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6702222 |
| Molecular Formula | C43H45N3O4S2 |
| Molecular Weight | 731.98 g/mol |
| Exact Mass | 731.29 |
| IUPAC Name | 1-(1-adamantyl)-3-[[2-[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | O=C(NCc1ccccc1-c1ccc([C@H]2O[C@@H](CSc3nc4ccccc4s3)C[C@@H](c3ccc(CO)cc3)O2)cc1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C43H45N3O4S2/c47-25-27-9-11-32(12-10-27)38-20-35(26-51-42-45-37-7-3-4-8-39(37)52-42)49-40(50-38)33-15-13-31(14-16-33)36-6-2-1-5-34(36)24-44-41(48)46-43-21-28-17-29(22-43)19-30(18-28)23-43/h1-16,28-30,35,38,40,47H,17-26H2,(H2,44,46,48)/t28?,29?,30?,35-,38+,40+,43?/m1/s1 |
| InChIKey | MBVNPJYUTLEFBJ-WRHYPIBCSA-N |
| XLogP | 9.56 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.98 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |