C37H36N2O6S2 — CID 6702206
[(2S)-1-[[2-[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-1-oxopropan-2-yl] acetate (PubChem CID 6702206) has the molecular formula C37H36N2O6S2 and a molecular weight of 668.84 g/mol. Its IUPAC name is [(2S)-1-[[2-[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-1-oxopropan-2-yl] acetate.
| Compound Name | [(2S)-1-[[2-[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 6702206 |
| Molecular Formula | C37H36N2O6S2 |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | [(2S)-1-[[2-[4-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-1-oxopropan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)C(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CSc3nc4ccccc4s3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C37H36N2O6S2/c1-23(43-24(2)41)35(42)38-20-29-7-3-4-8-31(29)26-15-17-28(18-16-26)36-44-30(19-33(45-36)27-13-11-25(21-40)12-14-27)22-46-37-39-32-9-5-6-10-34(32)47-37/h3-18,23,30,33,36,40H,19-22H2,1-2H3,(H,38,42)/t23-,30+,33-,36-/m0/s1 |
| InChIKey | PECLSRKESZFESP-BGCOOMRDSA-N |
| XLogP | 7.36 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |