C30H31N3O4S2 — CID 6695179
N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6695179) has the molecular formula C30H31N3O4S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6695179 |
| Molecular Formula | C30H31N3O4S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccccc1-c1ccc([C@@H]2O[C@H](CSc3nnc(C)s3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C30H31N3O4S2/c1-19(35)31-16-25-5-3-4-6-27(25)22-11-13-24(14-12-22)29-36-26(18-38-30-33-32-20(2)39-30)15-28(37-29)23-9-7-21(17-34)8-10-23/h3-14,26,28-29,34H,15-18H2,1-2H3,(H,31,35)/t26-,28+,29+/m0/s1 |
| InChIKey | AQHNJPBQNYBJLV-WIIGKZCBSA-N |
| XLogP | 5.98 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |