C29H30N4O4S2 — CID 6706625
1-benzyl-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6706625) has the molecular formula C29H30N4O4S2 and a molecular weight of 562.72 g/mol. Its IUPAC name is 1-benzyl-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-benzyl-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6706625 |
| Molecular Formula | C29H30N4O4S2 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 1-benzyl-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | Cc1nnc(SC[C@@H]2C[C@H](c3ccc(CO)cc3)O[C@H](c3ccc(NC(=O)NCc4ccccc4)cc3)O2)s1 |
| InChI | InChI=1S/C29H30N4O4S2/c1-19-32-33-29(39-19)38-18-25-15-26(22-9-7-21(17-34)8-10-22)37-27(36-25)23-11-13-24(14-12-23)31-28(35)30-16-20-5-3-2-4-6-20/h2-14,25-27,34H,15-18H2,1H3,(H2,30,31,35)/t25-,26+,27+/m0/s1 |
| InChIKey | PAISPSZAJMDQAJ-OYUWMTPXSA-N |
| XLogP | 6.00 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |