C27H32N4O6S2 — CID 6695141
ethyl 2-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]acetate (PubChem CID 6695141) has the molecular formula C27H32N4O6S2 and a molecular weight of 572.71 g/mol. Its IUPAC name is ethyl 2-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 6695141 |
| Molecular Formula | C27H32N4O6S2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | ethyl 2-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1ccc([C@@H]2O[C@H](CSc3nnc(C)s3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C27H32N4O6S2/c1-3-35-24(33)14-29-26(34)28-13-18-4-10-21(11-5-18)25-36-22(16-38-27-31-30-17(2)39-27)12-23(37-25)20-8-6-19(15-32)7-9-20/h4-11,22-23,25,32H,3,12-16H2,1-2H3,(H2,28,29,34)/t22-,23+,25+/m0/s1 |
| InChIKey | NNIWBOKYFRWBJZ-JBRSBNLGSA-N |
| XLogP | 4.04 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |