C28H29N3O5S3 — CID 6700623
N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]benzenesulfonamide (PubChem CID 6700623) has the molecular formula C28H29N3O5S3 and a molecular weight of 583.76 g/mol. Its IUPAC name is N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]benzenesulfonamide.
| Compound Name | N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6700623 |
| Molecular Formula | C28H29N3O5S3 |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1nnc(SC[C@H]2C[C@@H](c3ccc(CO)cc3)O[C@@H](c3ccc(CNS(=O)(=O)c4ccccc4)cc3)O2)s1 |
| InChI | InChI=1S/C28H29N3O5S3/c1-19-30-31-28(38-19)37-18-24-15-26(22-11-9-21(17-32)10-12-22)36-27(35-24)23-13-7-20(8-14-23)16-29-39(33,34)25-5-3-2-4-6-25/h2-14,24,26-27,29,32H,15-18H2,1H3/t24-,26+,27+/m1/s1 |
| InChIKey | GOLQMRGNXBQQAD-STXQHDJLSA-N |
| XLogP | 5.16 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |