C29H31N3O5S3 — CID 6689477
N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]benzenesulfonamide (PubChem CID 6689477) has the molecular formula C29H31N3O5S3 and a molecular weight of 597.78 g/mol. Its IUPAC name is N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]benzenesulfonamide.
| Compound Name | N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6689477 |
| Molecular Formula | C29H31N3O5S3 |
| Molecular Weight | 597.78 g/mol |
| Exact Mass | 597.14 |
| IUPAC Name | N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1nnc(SC[C@@H]2O[C@H](c3ccc(CNS(=O)(=O)c4ccccc4)cc3)OC(c3ccc(CO)cc3)[C@@H]2C)s1 |
| InChI | InChI=1S/C29H31N3O5S3/c1-19-26(18-38-29-32-31-20(2)39-29)36-28(37-27(19)23-12-10-22(17-33)11-13-23)24-14-8-21(9-15-24)16-30-40(34,35)25-6-4-3-5-7-25/h3-15,19,26-28,30,33H,16-18H2,1-2H3/t19-,26+,27?,28+/m1/s1 |
| InChIKey | MQEUYVMPNKTZML-VMLNKLAZSA-N |
| XLogP | 5.40 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.78 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |