C32H32N4O5S3 — CID 6680240
N-[[4-[(4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]quinoline-8-sulfonamide (PubChem CID 6680240) has the molecular formula C32H32N4O5S3 and a molecular weight of 648.83 g/mol. Its IUPAC name is N-[[4-[(4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]quinoline-8-sulfonamide.
| Compound Name | N-[[4-[(4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 6680240 |
| Molecular Formula | C32H32N4O5S3 |
| Molecular Weight | 648.83 g/mol |
| Exact Mass | 648.15 |
| IUPAC Name | N-[[4-[(4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]quinoline-8-sulfonamide |
| SMILES | Cc1nnc(SC[C@H]2OC(c3ccc(CNS(=O)(=O)c4cccc5cccnc45)cc3)O[C@@H](c3ccc(CO)cc3)[C@H]2C)s1 |
| InChI | InChI=1S/C32H32N4O5S3/c1-20-27(19-42-32-36-35-21(2)43-32)40-31(41-30(20)25-12-10-23(18-37)11-13-25)26-14-8-22(9-15-26)17-34-44(38,39)28-7-3-5-24-6-4-16-33-29(24)28/h3-16,20,27,30-31,34,37H,17-19H2,1-2H3/t20-,27+,30+,31?/m0/s1 |
| InChIKey | BGHYBSJWHHPGRP-ZNARTDTKSA-N |
| XLogP | 5.95 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.83 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |