C28H28N4O4S2 — CID 6705531
N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pyridine-3-carboxamide (PubChem CID 6705531) has the molecular formula C28H28N4O4S2 and a molecular weight of 548.69 g/mol. Its IUPAC name is N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6705531 |
| Molecular Formula | C28H28N4O4S2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pyridine-3-carboxamide |
| SMILES | Cc1nnc(SC[C@@H]2O[C@H](c3ccc(NC(=O)c4cccnc4)cc3)OC(c3ccc(CO)cc3)[C@@H]2C)s1 |
| InChI | InChI=1S/C28H28N4O4S2/c1-17-24(16-37-28-32-31-18(2)38-28)35-27(36-25(17)20-7-5-19(15-33)6-8-20)21-9-11-23(12-10-21)30-26(34)22-4-3-13-29-14-22/h3-14,17,24-25,27,33H,15-16H2,1-2H3,(H,30,34)/t17-,24+,25?,27+/m1/s1 |
| InChIKey | IEVLLCYRBWLBLX-KVGBOAPVSA-N |
| XLogP | 5.57 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |