C27H26N4O4S2 — CID 6706612
N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pyridine-3-carboxamide (PubChem CID 6706612) has the molecular formula C27H26N4O4S2 and a molecular weight of 534.66 g/mol. Its IUPAC name is N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6706612 |
| Molecular Formula | C27H26N4O4S2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pyridine-3-carboxamide |
| SMILES | Cc1nnc(SC[C@@H]2C[C@H](c3ccc(CO)cc3)O[C@H](c3ccc(NC(=O)c4cccnc4)cc3)O2)s1 |
| InChI | InChI=1S/C27H26N4O4S2/c1-17-30-31-27(37-17)36-16-23-13-24(19-6-4-18(15-32)5-7-19)35-26(34-23)20-8-10-22(11-9-20)29-25(33)21-3-2-12-28-14-21/h2-12,14,23-24,26,32H,13,15-16H2,1H3,(H,29,33)/t23-,24+,26+/m0/s1 |
| InChIKey | BFSIYCOVVKWPFQ-BFLUCZKCSA-N |
| XLogP | 5.32 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |