C28H34N4O6S2 — CID 3509549
N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]heptanediamide (PubChem CID 3509549) has the molecular formula C28H34N4O6S2 and a molecular weight of 586.74 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
|---|---|
| PubChem CID | 3509549 |
| Molecular Formula | C28H34N4O6S2 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
| SMILES | Cc1nnc(SCC2CC(c3ccc(CO)cc3)OC(c3ccc(NC(=O)CCCCCC(=O)NO)cc3)O2)s1 |
| InChI | InChI=1S/C28H34N4O6S2/c1-18-30-31-28(40-18)39-17-23-15-24(20-9-7-19(16-33)8-10-20)38-27(37-23)21-11-13-22(14-12-21)29-25(34)5-3-2-4-6-26(35)32-36/h7-14,23-24,27,33,36H,2-6,15-17H2,1H3,(H,29,34)(H,32,35) |
| InChIKey | YAWZPGVKILEHTB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|