C36H42N4O6S2 — CID 6677268
N'-hydroxy-N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide (PubChem CID 6677268) has the molecular formula C36H42N4O6S2 and a molecular weight of 690.89 g/mol. Its IUPAC name is N'-hydroxy-N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide.
| Compound Name | N'-hydroxy-N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 6677268 |
| Molecular Formula | C36H42N4O6S2 |
| Molecular Weight | 690.89 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | N'-hydroxy-N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
| SMILES | Cc1nnc(SC[C@@H]2C[C@H](c3ccc(CO)cc3)O[C@H](c3ccc(-c4cccc(CNC(=O)CCCCCCC(=O)NO)c4)cc3)O2)s1 |
| InChI | InChI=1S/C36H42N4O6S2/c1-24-38-39-36(48-24)47-23-31-20-32(28-13-11-25(22-41)12-14-28)46-35(45-31)29-17-15-27(16-18-29)30-8-6-7-26(19-30)21-37-33(42)9-4-2-3-5-10-34(43)40-44/h6-8,11-19,31-32,35,41,44H,2-5,9-10,20-23H2,1H3,(H,37,42)(H,40,43)/t31-,32+,35+/m0/s1 |
| InChIKey | NPXYKJNFBWJLFO-GTXBZULCSA-N |
| XLogP | 6.81 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.89 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|