C37H40N2O6S — CID 6676398
N'-hydroxy-N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide (PubChem CID 6676398) has the molecular formula C37H40N2O6S and a molecular weight of 640.80 g/mol. Its IUPAC name is N'-hydroxy-N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 6676398 |
| Molecular Formula | C37H40N2O6S |
| Molecular Weight | 640.80 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | N'-hydroxy-N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
| SMILES | O=C(CCCCC(=O)NCc1cccc(-c2ccc([C@@H]3O[C@H](CSc4ccccc4)C[C@H](c4ccc(CO)cc4)O3)cc2)c1)NO |
| InChI | InChI=1S/C37H40N2O6S/c40-24-26-13-15-29(16-14-26)34-22-32(25-46-33-9-2-1-3-10-33)44-37(45-34)30-19-17-28(18-20-30)31-8-6-7-27(21-31)23-38-35(41)11-4-5-12-36(42)39-43/h1-3,6-10,13-21,32,34,37,40,43H,4-5,11-12,22-25H2,(H,38,41)(H,39,42)/t32-,34+,37+/m0/s1 |
| InChIKey | GIPJYTMNGGMCJM-XNLCPIGASA-N |
| XLogP | 6.87 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.80 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|