C39H42N2O8S — CID 6677865
2-[[(2S,4S,6R)-2-[3-[3-[[[7-(hydroxyamino)-7-oxoheptanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6677865) has the molecular formula C39H42N2O8S and a molecular weight of 698.84 g/mol. Its IUPAC name is 2-[[(2S,4S,6R)-2-[3-[3-[[[7-(hydroxyamino)-7-oxoheptanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 2-[[(2S,4S,6R)-2-[3-[3-[[[7-(hydroxyamino)-7-oxoheptanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6677865 |
| Molecular Formula | C39H42N2O8S |
| Molecular Weight | 698.84 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | 2-[[(2S,4S,6R)-2-[3-[3-[[[7-(hydroxyamino)-7-oxoheptanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | O=C(CCCCCC(=O)NCc1cccc(-c2cccc([C@@H]3O[C@H](CSc4ccccc4C(=O)O)C[C@H](c4ccc(CO)cc4)O3)c2)c1)NO |
| InChI | InChI=1S/C39H42N2O8S/c42-24-26-16-18-28(19-17-26)34-22-32(25-50-35-13-5-4-12-33(35)38(45)46)48-39(49-34)31-11-7-10-30(21-31)29-9-6-8-27(20-29)23-40-36(43)14-2-1-3-15-37(44)41-47/h4-13,16-21,32,34,39,42,47H,1-3,14-15,22-25H2,(H,40,43)(H,41,44)(H,45,46)/t32-,34+,39+/m0/s1 |
| InChIKey | ZEFBGWZGCWITIM-BSKOTCCJSA-N |
| XLogP | 6.95 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.84 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|