C40H44N2O8S — CID 3638760
2-[[2-[4-[3-[[[8-(hydroxyamino)-8-oxooctanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 3638760) has the molecular formula C40H44N2O8S and a molecular weight of 712.87 g/mol. Its IUPAC name is 2-[[2-[4-[3-[[[8-(hydroxyamino)-8-oxooctanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 2-[[2-[4-[3-[[[8-(hydroxyamino)-8-oxooctanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 3638760 |
| Molecular Formula | C40H44N2O8S |
| Molecular Weight | 712.87 g/mol |
| Exact Mass | 712.28 |
| IUPAC Name | 2-[[2-[4-[3-[[[8-(hydroxyamino)-8-oxooctanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | O=C(CCCCCCC(=O)NCc1cccc(-c2ccc(C3OC(CSc4ccccc4C(=O)O)CC(c4ccc(CO)cc4)O3)cc2)c1)NO |
| InChI | InChI=1S/C40H44N2O8S/c43-25-27-14-16-30(17-15-27)35-23-33(26-51-36-11-6-5-10-34(36)39(46)47)49-40(50-35)31-20-18-29(19-21-31)32-9-7-8-28(22-32)24-41-37(44)12-3-1-2-4-13-38(45)42-48/h5-11,14-22,33,35,40,43,48H,1-4,12-13,23-26H2,(H,41,44)(H,42,45)(H,46,47) |
| InChIKey | TUMQJRCMPZJTCJ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.87 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|