C37H39N3O8S — CID 6677982
2-[[(2S,4S,6R)-2-[4-[3-[[[6-(hydroxyamino)-6-oxohexanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 6677982) has the molecular formula C37H39N3O8S and a molecular weight of 685.80 g/mol. Its IUPAC name is 2-[[(2S,4S,6R)-2-[4-[3-[[[6-(hydroxyamino)-6-oxohexanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[(2S,4S,6R)-2-[4-[3-[[[6-(hydroxyamino)-6-oxohexanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 6677982 |
| Molecular Formula | C37H39N3O8S |
| Molecular Weight | 685.80 g/mol |
| Exact Mass | 685.25 |
| IUPAC Name | 2-[[(2S,4S,6R)-2-[4-[3-[[[6-(hydroxyamino)-6-oxohexanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | O=C(CCCCC(=O)NCc1cccc(-c2ccc([C@@H]3O[C@H](CSc4ncccc4C(=O)O)C[C@H](c4ccc(CO)cc4)O3)cc2)c1)NO |
| InChI | InChI=1S/C37H39N3O8S/c41-22-24-10-12-27(13-11-24)32-20-30(23-49-35-31(36(44)45)7-4-18-38-35)47-37(48-32)28-16-14-26(15-17-28)29-6-3-5-25(19-29)21-39-33(42)8-1-2-9-34(43)40-46/h3-7,10-19,30,32,37,41,46H,1-2,8-9,20-23H2,(H,39,42)(H,40,43)(H,44,45)/t30-,32+,37+/m0/s1 |
| InChIKey | SOZQHPHBTOAHPV-WHMCYVJPSA-N |
| XLogP | 5.96 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.80 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|