C32H37N3O8S — CID 4280936
2-[[2-[4-[[[7-(hydroxyamino)-7-oxoheptanoyl]amino]methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 4280936) has the molecular formula C32H37N3O8S and a molecular weight of 623.73 g/mol. Its IUPAC name is 2-[[2-[4-[[[7-(hydroxyamino)-7-oxoheptanoyl]amino]methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[2-[4-[[[7-(hydroxyamino)-7-oxoheptanoyl]amino]methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 4280936 |
| Molecular Formula | C32H37N3O8S |
| Molecular Weight | 623.73 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | 2-[[2-[4-[[[7-(hydroxyamino)-7-oxoheptanoyl]amino]methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | O=C(CCCCCC(=O)NCc1ccc(C2OC(CSc3ncccc3C(=O)O)CC(c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C32H37N3O8S/c36-19-22-10-12-23(13-11-22)27-17-25(20-44-30-26(31(39)40)5-4-16-33-30)42-32(43-27)24-14-8-21(9-15-24)18-34-28(37)6-2-1-3-7-29(38)35-41/h4-5,8-16,25,27,32,36,41H,1-3,6-7,17-20H2,(H,34,37)(H,35,38)(H,39,40) |
| InChIKey | MLFQCFVNLGMUDI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.73 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|