C32H39N3O6S — CID 6672864
N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]octanediamide (PubChem CID 6672864) has the molecular formula C32H39N3O6S and a molecular weight of 593.75 g/mol. Its IUPAC name is N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]octanediamide.
| Compound Name | N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 6672864 |
| Molecular Formula | C32H39N3O6S |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]octanediamide |
| SMILES | O=C(CCCCCCC(=O)NCc1ccc([C@H]2O[C@@H](CSc3ccccn3)C[C@@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C32H39N3O6S/c36-21-24-12-14-25(15-13-24)28-19-27(22-42-31-9-5-6-18-33-31)40-32(41-28)26-16-10-23(11-17-26)20-34-29(37)7-3-1-2-4-8-30(38)35-39/h5-6,9-18,27-28,32,36,39H,1-4,7-8,19-22H2,(H,34,37)(H,35,38)/t27-,28+,32+/m1/s1 |
| InChIKey | LPSKNURUYMNCQJ-CPEGRYNBSA-N |
| XLogP | 5.37 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|