C29H33N3O6S — CID 5207425
N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 5207425) has the molecular formula C29H33N3O6S and a molecular weight of 551.67 g/mol. Its IUPAC name is N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 5207425 |
| Molecular Formula | C29H33N3O6S |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | O=C(CCCCC(=O)Nc1cccc(C2OC(CSc3ccccn3)CC(c3ccc(CO)cc3)O2)c1)NO |
| InChI | InChI=1S/C29H33N3O6S/c33-18-20-11-13-21(14-12-20)25-17-24(19-39-28-10-3-4-15-30-28)37-29(38-25)22-6-5-7-23(16-22)31-26(34)8-1-2-9-27(35)32-36/h3-7,10-16,24-25,29,33,36H,1-2,8-9,17-19H2,(H,31,34)(H,32,35) |
| InChIKey | HMZKJNUCGBSGPC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|