C28H34N4O6S — CID 3997189
N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 3997189) has the molecular formula C28H34N4O6S and a molecular weight of 554.67 g/mol. Its IUPAC name is N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 3997189 |
| Molecular Formula | C28H34N4O6S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | Cn1ccnc1SCC1CC(c2ccc(CO)cc2)OC(c2cccc(NC(=O)CCCCC(=O)NO)c2)O1 |
| InChI | InChI=1S/C28H34N4O6S/c1-32-14-13-29-28(32)39-18-23-16-24(20-11-9-19(17-33)10-12-20)38-27(37-23)21-5-4-6-22(15-21)30-25(34)7-2-3-8-26(35)31-36/h4-6,9-15,23-24,27,33,36H,2-3,7-8,16-18H2,1H3,(H,30,34)(H,31,35) |
| InChIKey | YKUVCAOMVYZPLQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|