C34H38N4O6S — CID 6673107
N'-hydroxy-N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide (PubChem CID 6673107) has the molecular formula C34H38N4O6S and a molecular weight of 630.77 g/mol. Its IUPAC name is N'-hydroxy-N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide.
| Compound Name | N'-hydroxy-N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 6673107 |
| Molecular Formula | C34H38N4O6S |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | N'-hydroxy-N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
| SMILES | Cn1ccnc1SC[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNC(=O)CCCC(=O)NO)c3)c2)O1 |
| InChI | InChI=1S/C34H38N4O6S/c1-38-16-15-35-34(38)45-22-29-19-30(25-13-11-23(21-39)12-14-25)44-33(43-29)28-8-3-7-27(18-28)26-6-2-5-24(17-26)20-36-31(40)9-4-10-32(41)37-42/h2-3,5-8,11-18,29-30,33,39,42H,4,9-10,19-22H2,1H3,(H,36,40)(H,37,41)/t29-,30+,33+/m1/s1 |
| InChIKey | LMNCQQUYLPARSH-ROCBYOHGSA-N |
| XLogP | 5.21 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|