C38H43N3O6S — CID 6676500
N'-hydroxy-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide (PubChem CID 6676500) has the molecular formula C38H43N3O6S and a molecular weight of 669.84 g/mol. Its IUPAC name is N'-hydroxy-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide.
| Compound Name | N'-hydroxy-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 6676500 |
| Molecular Formula | C38H43N3O6S |
| Molecular Weight | 669.84 g/mol |
| Exact Mass | 669.29 |
| IUPAC Name | N'-hydroxy-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
| SMILES | O=C(CCCCCCC(=O)NCc1cccc(-c2cccc([C@@H]3O[C@H](CSc4ccccn4)C[C@H](c4ccc(CO)cc4)O3)c2)c1)NO |
| InChI | InChI=1S/C38H43N3O6S/c42-25-27-16-18-29(19-17-27)34-23-33(26-48-37-15-5-6-20-39-37)46-38(47-34)32-12-8-11-31(22-32)30-10-7-9-28(21-30)24-40-35(43)13-3-1-2-4-14-36(44)41-45/h5-12,15-22,33-34,38,42,45H,1-4,13-14,23-26H2,(H,40,43)(H,41,44)/t33-,34+,38+/m0/s1 |
| InChIKey | NWERRTILLTWURO-ZVRNNNLDSA-N |
| XLogP | 7.04 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.84 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|