C40H44N6O6S — CID 6678588
N'-hydroxy-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide (PubChem CID 6678588) has the molecular formula C40H44N6O6S and a molecular weight of 736.89 g/mol. Its IUPAC name is N'-hydroxy-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide.
| Compound Name | N'-hydroxy-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 6678588 |
| Molecular Formula | C40H44N6O6S |
| Molecular Weight | 736.89 g/mol |
| Exact Mass | 736.30 |
| IUPAC Name | N'-hydroxy-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
| SMILES | O=C(CCCCCCC(=O)NCc1cccc(-c2cccc([C@@H]3O[C@H](CSc4nnnn4-c4ccccc4)C[C@H](c4ccc(CO)cc4)O3)c2)c1)NO |
| InChI | InChI=1S/C40H44N6O6S/c47-26-28-18-20-30(21-19-28)36-24-35(27-53-40-42-44-45-46(40)34-14-4-3-5-15-34)51-39(52-36)33-13-9-12-32(23-33)31-11-8-10-29(22-31)25-41-37(48)16-6-1-2-7-17-38(49)43-50/h3-5,8-15,18-23,35-36,39,47,50H,1-2,6-7,16-17,24-27H2,(H,41,48)(H,43,49)/t35-,36+,39+/m0/s1 |
| InChIKey | PXVUJSOURBCVIP-RETAKORUSA-N |
| XLogP | 6.62 |
| TPSA | 160.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.89 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|