C31H33N5O6S — CID 4002901
6-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid (PubChem CID 4002901) has the molecular formula C31H33N5O6S and a molecular weight of 603.70 g/mol. Its IUPAC name is 6-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid.
| Compound Name | 6-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 4002901 |
| Molecular Formula | C31H33N5O6S |
| Molecular Weight | 603.70 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | 6-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)Nc1cccc(C2OC(CSc3nnnn3-c3ccccc3)CC(c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C31H33N5O6S/c37-19-21-13-15-22(16-14-21)27-18-26(20-43-31-33-34-35-36(31)25-9-2-1-3-10-25)41-30(42-27)23-7-6-8-24(17-23)32-28(38)11-4-5-12-29(39)40/h1-3,6-10,13-17,26-27,30,37H,4-5,11-12,18-20H2,(H,32,38)(H,39,40) |
| InChIKey | FLSBDOCQWJKGFS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.70 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|