C27H33N5O6S — CID 3953494
N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 3953494) has the molecular formula C27H33N5O6S and a molecular weight of 555.66 g/mol. Its IUPAC name is N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 3953494 |
| Molecular Formula | C27H33N5O6S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | Cn1cnnc1SCC1CC(c2ccc(CO)cc2)OC(c2cccc(NC(=O)CCCCC(=O)NO)c2)O1 |
| InChI | InChI=1S/C27H33N5O6S/c1-32-17-28-30-27(32)39-16-22-14-23(19-11-9-18(15-33)10-12-19)38-26(37-22)20-5-4-6-21(13-20)29-24(34)7-2-3-8-25(35)31-36/h4-6,9-13,17,22-23,26,33,36H,2-3,7-8,14-16H2,1H3,(H,29,34)(H,31,35) |
| InChIKey | ZGJGYPOQGMTKNZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 147.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|