C33H38N6O5S — CID 3912730
N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 3912730) has the molecular formula C33H38N6O5S and a molecular weight of 630.77 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 3912730 |
| Molecular Formula | C33H38N6O5S |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.26 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | Cn1cnnc1SCC1CC(c2ccc(CO)cc2)OC(c2cccc(NC(=O)CCCCC(=O)Nc3ccccc3N)c2)O1 |
| InChI | InChI=1S/C33H38N6O5S/c1-39-21-35-38-33(39)45-20-26-18-29(23-15-13-22(19-40)14-16-23)44-32(43-26)24-7-6-8-25(17-24)36-30(41)11-4-5-12-31(42)37-28-10-3-2-9-27(28)34/h2-3,6-10,13-17,21,26,29,32,40H,4-5,11-12,18-20,34H2,1H3,(H,36,41)(H,37,42) |
| InChIKey | NSOSEUHZKRIRCI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|