C32H37N7O5S — CID 6673267
N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 6673267) has the molecular formula C32H37N7O5S and a molecular weight of 631.76 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 6673267 |
| Molecular Formula | C32H37N7O5S |
| Molecular Weight | 631.76 g/mol |
| Exact Mass | 631.26 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | Cn1nnnc1SC[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)CCCCC(=O)Nc3ccccc3N)c2)O1 |
| InChI | InChI=1S/C32H37N7O5S/c1-39-32(36-37-38-39)45-20-25-18-28(22-15-13-21(19-40)14-16-22)44-31(43-25)23-7-6-8-24(17-23)34-29(41)11-4-5-12-30(42)35-27-10-3-2-9-26(27)33/h2-3,6-10,13-17,25,28,31,40H,4-5,11-12,18-20,33H2,1H3,(H,34,41)(H,35,42)/t25-,28+,31+/m1/s1 |
| InChIKey | WYXPFJYCIKVXQC-VUAYVDPTSA-N |
| XLogP | 4.76 |
| TPSA | 166.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.76 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|