C31H36N2O7S — CID 3874610
N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 3874610) has the molecular formula C31H36N2O7S and a molecular weight of 580.70 g/mol. Its IUPAC name is N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 3874610 |
| Molecular Formula | C31H36N2O7S |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | COc1ccccc1SCC1CC(c2ccc(CO)cc2)OC(c2cccc(NC(=O)CCCCC(=O)NO)c2)O1 |
| InChI | InChI=1S/C31H36N2O7S/c1-38-26-9-2-3-10-28(26)41-20-25-18-27(22-15-13-21(19-34)14-16-22)40-31(39-25)23-7-6-8-24(17-23)32-29(35)11-4-5-12-30(36)33-37/h2-3,6-10,13-17,25,27,31,34,37H,4-5,11-12,18-20H2,1H3,(H,32,35)(H,33,36) |
| InChIKey | XMGBXZPGSBMCGH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|