C32H37NO7S — CID 6673916
7-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid (PubChem CID 6673916) has the molecular formula C32H37NO7S and a molecular weight of 579.72 g/mol. Its IUPAC name is 7-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid.
| Compound Name | 7-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 6673916 |
| Molecular Formula | C32H37NO7S |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | 7-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
| SMILES | COc1ccccc1SC[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)CCCCCC(=O)O)c2)O1 |
| InChI | InChI=1S/C32H37NO7S/c1-38-27-10-5-6-11-29(27)41-21-26-19-28(23-16-14-22(20-34)15-17-23)40-32(39-26)24-8-7-9-25(18-24)33-30(35)12-3-2-4-13-31(36)37/h5-11,14-18,26,28,32,34H,2-4,12-13,19-21H2,1H3,(H,33,35)(H,36,37)/t26-,28+,32+/m1/s1 |
| InChIKey | YLPRCROXRHTFIA-LNGZGTQPSA-N |
| XLogP | 6.50 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|