C31H35NO7S — CID 6673925
6-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid (PubChem CID 6673925) has the molecular formula C31H35NO7S and a molecular weight of 565.69 g/mol. Its IUPAC name is 6-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid.
| Compound Name | 6-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 6673925 |
| Molecular Formula | C31H35NO7S |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | 6-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid |
| SMILES | COc1ccccc1SC[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(NC(=O)CCCCC(=O)O)cc2)O1 |
| InChI | InChI=1S/C31H35NO7S/c1-37-26-6-2-3-7-28(26)40-20-25-18-27(22-12-10-21(19-33)11-13-22)39-31(38-25)23-14-16-24(17-15-23)32-29(34)8-4-5-9-30(35)36/h2-3,6-7,10-17,25,27,31,33H,4-5,8-9,18-20H2,1H3,(H,32,34)(H,35,36)/t25-,27+,31+/m1/s1 |
| InChIKey | SGEMKGJZGYFREM-NFWIRQETSA-N |
| XLogP | 6.11 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|