C31H33NO8S — CID 6677813
2-[[(2S,4S,6R)-2-[4-(5-carboxypentanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6677813) has the molecular formula C31H33NO8S and a molecular weight of 579.67 g/mol. Its IUPAC name is 2-[[(2S,4S,6R)-2-[4-(5-carboxypentanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 2-[[(2S,4S,6R)-2-[4-(5-carboxypentanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6677813 |
| Molecular Formula | C31H33NO8S |
| Molecular Weight | 579.67 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | 2-[[(2S,4S,6R)-2-[4-(5-carboxypentanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | O=C(O)CCCCC(=O)Nc1ccc([C@@H]2O[C@H](CSc3ccccc3C(=O)O)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C31H33NO8S/c33-18-20-9-11-21(12-10-20)26-17-24(19-41-27-6-2-1-5-25(27)30(37)38)39-31(40-26)22-13-15-23(16-14-22)32-28(34)7-3-4-8-29(35)36/h1-2,5-6,9-16,24,26,31,33H,3-4,7-8,17-19H2,(H,32,34)(H,35,36)(H,37,38)/t24-,26+,31+/m0/s1 |
| InChIKey | FPZJTVVSBFQRIL-UZXRVZLOSA-N |
| XLogP | 5.80 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.67 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|