C28H30N2O7S — CID 6677162
5-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid (PubChem CID 6677162) has the molecular formula C28H30N2O7S and a molecular weight of 538.62 g/mol. Its IUPAC name is 5-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid.
| Compound Name | 5-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6677162 |
| Molecular Formula | C28H30N2O7S |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 5-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)Nc1ccc([C@@H]2O[C@H](CSc3cccc[n+]3[O-])C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C28H30N2O7S/c31-17-19-7-9-20(10-8-19)24-16-23(18-38-26-5-1-2-15-30(26)35)36-28(37-24)21-11-13-22(14-12-21)29-25(32)4-3-6-27(33)34/h1-2,5,7-15,23-24,28,31H,3-4,6,16-18H2,(H,29,32)(H,33,34)/t23-,24+,28+/m0/s1 |
| InChIKey | QZTWCQRMVSILFA-VYKTZEHYSA-N |
| XLogP | 4.34 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|