C37H35N3O6S — CID 6695033
1-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]-3-(4-phenoxyphenyl)urea (PubChem CID 6695033) has the molecular formula C37H35N3O6S and a molecular weight of 649.77 g/mol. Its IUPAC name is 1-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 6695033 |
| Molecular Formula | C37H35N3O6S |
| Molecular Weight | 649.77 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | 1-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
| SMILES | O=C(NCc1ccc([C@@H]2O[C@H](CSc3cccc[n+]3[O-])C[C@H](c3ccc(CO)cc3)O2)cc1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C37H35N3O6S/c41-24-27-11-13-28(14-12-27)34-22-33(25-47-35-8-4-5-21-40(35)43)45-36(46-34)29-15-9-26(10-16-29)23-38-37(42)39-30-17-19-32(20-18-30)44-31-6-2-1-3-7-31/h1-21,33-34,36,41H,22-25H2,(H2,38,39,42)/t33-,34+,36+/m0/s1 |
| InChIKey | OQEFABVRULVOKO-GABYNLOESA-N |
| XLogP | 7.26 |
| TPSA | 115.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.77 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|