C31H36N2O7S — CID 6677180
7-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylamino]-7-oxoheptanoic acid (PubChem CID 6677180) has the molecular formula C31H36N2O7S and a molecular weight of 580.70 g/mol. Its IUPAC name is 7-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylamino]-7-oxoheptanoic acid.
| Compound Name | 7-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylamino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 6677180 |
| Molecular Formula | C31H36N2O7S |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | 7-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylamino]-7-oxoheptanoic acid |
| SMILES | O=C(O)CCCCCC(=O)NCc1ccc([C@@H]2O[C@H](CSc3cccc[n+]3[O-])C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C31H36N2O7S/c34-20-23-11-13-24(14-12-23)27-18-26(21-41-29-7-4-5-17-33(29)38)39-31(40-27)25-15-9-22(10-16-25)19-32-28(35)6-2-1-3-8-30(36)37/h4-5,7,9-17,26-27,31,34H,1-3,6,8,18-21H2,(H,32,35)(H,36,37)/t26-,27+,31+/m0/s1 |
| InChIKey | VGOIECHNPXDXNW-SWFBWHSRSA-N |
| XLogP | 4.80 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|