C31H25F5N2O5S — CID 4065886
2,3,4,5,6-pentafluoro-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide (PubChem CID 4065886) has the molecular formula C31H25F5N2O5S and a molecular weight of 632.61 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 4065886 |
| Molecular Formula | C31H25F5N2O5S |
| Molecular Weight | 632.61 g/mol |
| Exact Mass | 632.14 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(C2OC(CSc3cccc[n+]3[O-])CC(c3ccc(CO)cc3)O2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C31H25F5N2O5S/c32-25-24(26(33)28(35)29(36)27(25)34)30(40)37-14-17-4-10-20(11-5-17)31-42-21(16-44-23-3-1-2-12-38(23)41)13-22(43-31)19-8-6-18(15-39)7-9-19/h1-12,21-22,31,39H,13-16H2,(H,37,40) |
| InChIKey | QRVIKZZIHLPKAC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.61 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|