C23H24N2O4S — CID 6700486
[4-[(2R,4S,6R)-2-(3-aminophenyl)-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6700486) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is [4-[(2R,4S,6R)-2-(3-aminophenyl)-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(2R,4S,6R)-2-(3-aminophenyl)-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6700486 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | [4-[(2R,4S,6R)-2-(3-aminophenyl)-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | Nc1cccc([C@H]2O[C@@H](CSc3cccc[n+]3[O-])C[C@@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C23H24N2O4S/c24-19-5-3-4-18(12-19)23-28-20(15-30-22-6-1-2-11-25(22)27)13-21(29-23)17-9-7-16(14-26)8-10-17/h1-12,20-21,23,26H,13-15,24H2/t20-,21+,23+/m1/s1 |
| InChIKey | FDSGRBUSCUQDKS-GIWBLDEGSA-N |
| XLogP | 3.73 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|