C33H26F5NO6S — CID 6696010
2-[[(2S,4S,6R)-6-[4-(hydroxymethyl)phenyl]-2-[4-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6696010) has the molecular formula C33H26F5NO6S and a molecular weight of 659.63 g/mol. Its IUPAC name is 2-[[(2S,4S,6R)-6-[4-(hydroxymethyl)phenyl]-2-[4-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 2-[[(2S,4S,6R)-6-[4-(hydroxymethyl)phenyl]-2-[4-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6696010 |
| Molecular Formula | C33H26F5NO6S |
| Molecular Weight | 659.63 g/mol |
| Exact Mass | 659.14 |
| IUPAC Name | 2-[[(2S,4S,6R)-6-[4-(hydroxymethyl)phenyl]-2-[4-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1SC[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(CNC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)O1 |
| InChI | InChI=1S/C33H26F5NO6S/c34-26-25(27(35)29(37)30(38)28(26)36)31(41)39-14-17-5-11-20(12-6-17)33-44-21(16-46-24-4-2-1-3-22(24)32(42)43)13-23(45-33)19-9-7-18(15-40)8-10-19/h1-12,21,23,33,40H,13-16H2,(H,39,41)(H,42,43)/t21-,23+,33+/m0/s1 |
| InChIKey | HWRRMPXKOXOKTB-XGUJDVQYSA-N |
| XLogP | 6.84 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.63 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|