C39H30F5NO6S — CID 4083086
2-[[6-[4-(hydroxymethyl)phenyl]-2-[3-[3-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 4083086) has the molecular formula C39H30F5NO6S and a molecular weight of 735.73 g/mol. Its IUPAC name is 2-[[6-[4-(hydroxymethyl)phenyl]-2-[3-[3-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 2-[[6-[4-(hydroxymethyl)phenyl]-2-[3-[3-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 4083086 |
| Molecular Formula | C39H30F5NO6S |
| Molecular Weight | 735.73 g/mol |
| Exact Mass | 735.17 |
| IUPAC Name | 2-[[6-[4-(hydroxymethyl)phenyl]-2-[3-[3-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1SCC1CC(c2ccc(CO)cc2)OC(c2cccc(-c3cccc(CNC(=O)c4c(F)c(F)c(F)c(F)c4F)c3)c2)O1 |
| InChI | InChI=1S/C39H30F5NO6S/c40-32-31(33(41)35(43)36(44)34(32)42)37(47)45-18-22-5-3-6-24(15-22)25-7-4-8-26(16-25)39-50-27(20-52-30-10-2-1-9-28(30)38(48)49)17-29(51-39)23-13-11-21(19-46)12-14-23/h1-16,27,29,39,46H,17-20H2,(H,45,47)(H,48,49) |
| InChIKey | GIIKPJFBIKDDJB-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.73 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|