C39H29F5N2O4S2 — CID 6696736
N-[[3-[3-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 6696736) has the molecular formula C39H29F5N2O4S2 and a molecular weight of 748.79 g/mol. Its IUPAC name is N-[[3-[3-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[[3-[3-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 6696736 |
| Molecular Formula | C39H29F5N2O4S2 |
| Molecular Weight | 748.79 g/mol |
| Exact Mass | 748.15 |
| IUPAC Name | N-[[3-[3-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(NCc1cccc(-c2cccc([C@@H]3O[C@H](CSc4nc5ccccc5s4)C[C@H](c4ccc(CO)cc4)O3)c2)c1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C39H29F5N2O4S2/c40-32-31(33(41)35(43)36(44)34(32)42)37(48)45-18-22-5-3-6-24(15-22)25-7-4-8-26(16-25)38-49-27(17-29(50-38)23-13-11-21(19-47)12-14-23)20-51-39-46-28-9-1-2-10-30(28)52-39/h1-16,27,29,38,47H,17-20H2,(H,45,48)/t27-,29+,38+/m0/s1 |
| InChIKey | CXKVHQFHFYWMOI-OIGFXNQZSA-N |
| XLogP | 9.42 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.79 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|