C38H30F5NO4S — CID 4195402
2,3,4,5,6-pentafluoro-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 4195402) has the molecular formula C38H30F5NO4S and a molecular weight of 691.72 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 4195402 |
| Molecular Formula | C38H30F5NO4S |
| Molecular Weight | 691.72 g/mol |
| Exact Mass | 691.18 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(-c2cccc(C3OC(CSc4ccccc4)CC(c4ccc(CO)cc4)O3)c2)c1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C38H30F5NO4S/c39-32-31(33(40)35(42)36(43)34(32)41)37(46)44-19-23-6-4-7-25(16-23)26-8-5-9-27(17-26)38-47-28(21-49-29-10-2-1-3-11-29)18-30(48-38)24-14-12-22(20-45)13-15-24/h1-17,28,30,38,45H,18-21H2,(H,44,46) |
| InChIKey | PGZGULHYODKMMD-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.72 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|