C32H24F5NO6S — CID 4174565
4-[[6-[4-(hydroxymethyl)phenyl]-2-[3-[(2,3,4,5,6-pentafluorobenzoyl)amino]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 4174565) has the molecular formula C32H24F5NO6S and a molecular weight of 645.60 g/mol. Its IUPAC name is 4-[[6-[4-(hydroxymethyl)phenyl]-2-[3-[(2,3,4,5,6-pentafluorobenzoyl)amino]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[6-[4-(hydroxymethyl)phenyl]-2-[3-[(2,3,4,5,6-pentafluorobenzoyl)amino]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 4174565 |
| Molecular Formula | C32H24F5NO6S |
| Molecular Weight | 645.60 g/mol |
| Exact Mass | 645.12 |
| IUPAC Name | 4-[[6-[4-(hydroxymethyl)phenyl]-2-[3-[(2,3,4,5,6-pentafluorobenzoyl)amino]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | O=C(O)c1ccc(SCC2CC(c3ccc(CO)cc3)OC(c3cccc(NC(=O)c4c(F)c(F)c(F)c(F)c4F)c3)O2)cc1 |
| InChI | InChI=1S/C32H24F5NO6S/c33-25-24(26(34)28(36)29(37)27(25)35)30(40)38-20-3-1-2-19(12-20)32-43-21(15-45-22-10-8-18(9-11-22)31(41)42)13-23(44-32)17-6-4-16(14-39)5-7-17/h1-12,21,23,32,39H,13-15H2,(H,38,40)(H,41,42) |
| InChIKey | HIBRKIKVVSPQHZ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.60 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|