C33H37NO8S — CID 6674279
4-[[(2R,4R,6S)-2-[3-(7-carboxyheptanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6674279) has the molecular formula C33H37NO8S and a molecular weight of 607.73 g/mol. Its IUPAC name is 4-[[(2R,4R,6S)-2-[3-(7-carboxyheptanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2R,4R,6S)-2-[3-(7-carboxyheptanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6674279 |
| Molecular Formula | C33H37NO8S |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | 4-[[(2R,4R,6S)-2-[3-(7-carboxyheptanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | O=C(O)CCCCCCC(=O)Nc1cccc([C@H]2O[C@@H](CSc3ccc(C(=O)O)cc3)C[C@@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C33H37NO8S/c35-20-22-10-12-23(13-11-22)29-19-27(21-43-28-16-14-24(15-17-28)32(39)40)41-33(42-29)25-6-5-7-26(18-25)34-30(36)8-3-1-2-4-9-31(37)38/h5-7,10-18,27,29,33,35H,1-4,8-9,19-21H2,(H,34,36)(H,37,38)(H,39,40)/t27-,29+,33+/m1/s1 |
| InChIKey | NRSZOUXJRVJGOW-ZFQPXVTNSA-N |
| XLogP | 6.58 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|