C33H38N2O8S — CID 3993508
4-[[2-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 3993508) has the molecular formula C33H38N2O8S and a molecular weight of 622.74 g/mol. Its IUPAC name is 4-[[2-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[2-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 3993508 |
| Molecular Formula | C33H38N2O8S |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | 4-[[2-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc(C2OC(CSc3ccc(C(=O)O)cc3)CC(c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C33H38N2O8S/c36-20-22-7-9-23(10-8-22)29-19-27(21-44-28-17-13-24(14-18-28)32(39)40)42-33(43-29)25-11-15-26(16-12-25)34-30(37)5-3-1-2-4-6-31(38)35-41/h7-18,27,29,33,36,41H,1-6,19-21H2,(H,34,37)(H,35,38)(H,39,40) |
| InChIKey | OUHLFSDGEIUAKU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|