C32H36N2O8S — CID 5197027
4-[[2-[4-[[[6-(hydroxyamino)-6-oxohexanoyl]amino]methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 5197027) has the molecular formula C32H36N2O8S and a molecular weight of 608.71 g/mol. Its IUPAC name is 4-[[2-[4-[[[6-(hydroxyamino)-6-oxohexanoyl]amino]methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[2-[4-[[[6-(hydroxyamino)-6-oxohexanoyl]amino]methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 5197027 |
| Molecular Formula | C32H36N2O8S |
| Molecular Weight | 608.71 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | 4-[[2-[4-[[[6-(hydroxyamino)-6-oxohexanoyl]amino]methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | O=C(CCCCC(=O)NCc1ccc(C2OC(CSc3ccc(C(=O)O)cc3)CC(c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C32H36N2O8S/c35-19-22-7-9-23(10-8-22)28-17-26(20-43-27-15-13-24(14-16-27)31(38)39)41-32(42-28)25-11-5-21(6-12-25)18-33-29(36)3-1-2-4-30(37)34-40/h5-16,26,28,32,35,40H,1-4,17-20H2,(H,33,36)(H,34,37)(H,38,39) |
| InChIKey | WYSWLLSGYPUZSJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|