C31H36N2O6S — CID 6672786
N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide (PubChem CID 6672786) has the molecular formula C31H36N2O6S and a molecular weight of 564.70 g/mol. Its IUPAC name is N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 6672786 |
| Molecular Formula | C31H36N2O6S |
| Molecular Weight | 564.70 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide |
| SMILES | O=C(CCCCC(=O)NCc1ccc([C@H]2O[C@@H](CSc3ccccc3)C[C@@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C31H36N2O6S/c34-20-23-12-14-24(15-13-23)28-18-26(21-40-27-6-2-1-3-7-27)38-31(39-28)25-16-10-22(11-17-25)19-32-29(35)8-4-5-9-30(36)33-37/h1-3,6-7,10-17,26,28,31,34,37H,4-5,8-9,18-21H2,(H,32,35)(H,33,36)/t26-,28+,31+/m1/s1 |
| InChIKey | RTKZDLZIQIAKRG-RDLJJFNOSA-N |
| XLogP | 5.20 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.70 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|