C42H45N3O7S — CID 6675816
N-[[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyoctanediamide (PubChem CID 6675816) has the molecular formula C42H45N3O7S and a molecular weight of 735.90 g/mol. Its IUPAC name is N-[[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 6675816 |
| Molecular Formula | C42H45N3O7S |
| Molecular Weight | 735.90 g/mol |
| Exact Mass | 735.30 |
| IUPAC Name | N-[[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)NCc1ccc([C@H]2O[C@@H](CSc3nc(-c4ccccc4)c(-c4ccccc4)o3)C[C@@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C42H45N3O7S/c46-27-30-19-21-31(22-20-30)36-25-35(28-53-42-44-39(32-11-5-3-6-12-32)40(52-42)33-13-7-4-8-14-33)50-41(51-36)34-23-17-29(18-24-34)26-43-37(47)15-9-1-2-10-16-38(48)45-49/h3-8,11-14,17-24,35-36,41,46,49H,1-2,9-10,15-16,25-28H2,(H,43,47)(H,45,48)/t35-,36+,41+/m1/s1 |
| InChIKey | XBQWUJUREXJWAV-YBCDPXEJSA-N |
| XLogP | 8.30 |
| TPSA | 143.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.90 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|